C20H24NO5+ — CID 7055115
(1S)-4,5,13,14-tetramethoxy-9-azoniatetracyclo[7.7.1.02,7.011,16]heptadeca-2,4,6,11,13,15-hexaen-6-ol (PubChem CID 7055115) has the molecular formula C20H24NO5+ and a molecular weight of 358.41 g/mol. Its IUPAC name is (1S)-4,5,13,14-tetramethoxy-9-azoniatetracyclo[7.7.1.02,7.011,16]heptadeca-2,4,6,11,13,15-hexaen-6-ol.
| Compound Name | (1S)-4,5,13,14-tetramethoxy-9-azoniatetracyclo[7.7.1.02,7.011,16]heptadeca-2,4,6,11,13,15-hexaen-6-ol |
|---|---|
| PubChem CID | 7055115 |
| Molecular Formula | C20H24NO5+ |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | (1S)-4,5,13,14-tetramethoxy-9-azoniatetracyclo[7.7.1.02,7.011,16]heptadeca-2,4,6,11,13,15-hexaen-6-ol |
| SMILES | COc1cc2c(cc1OC)[C@@H]1C[NH+](C2)Cc2c1cc(OC)c(OC)c2O |
| InChI | InChI=1S/C20H23NO5/c1-23-16-5-11-8-21-9-14(12(11)6-17(16)24-2)13-7-18(25-3)20(26-4)19(22)15(13)10-21/h5-7,14,22H,8-10H2,1-4H3/p+1/t14-/m0/s1 |
| InChIKey | GDBPLVSBOLIGLL-AWEZNQCLSA-O |
| XLogP | 1.47 |
| TPSA | 61.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|