C29H34FNO4 — CID 70556669
N-benzyl-2-[(6S,8S,9S,10R,11S,13S,14S,16R,17S)-6-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoacetamide (PubChem CID 70556669) has the molecular formula C29H34FNO4 and a molecular weight of 479.59 g/mol. Its IUPAC name is N-benzyl-2-[(6S,8S,9S,10R,11S,13S,14S,16R,17S)-6-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoacetamide.
| Compound Name | N-benzyl-2-[(6S,8S,9S,10R,11S,13S,14S,16R,17S)-6-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 70556669 |
| Molecular Formula | C29H34FNO4 |
| Molecular Weight | 479.59 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | N-benzyl-2-[(6S,8S,9S,10R,11S,13S,14S,16R,17S)-6-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoacetamide |
| SMILES | C[C@@H]1C[C@H]2[C@@H]3C[C@H](F)C4=CC(=O)C=C[C@]4(C)[C@H]3[C@@H](O)C[C@]2(C)[C@H]1C(=O)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C29H34FNO4/c1-16-11-20-19-13-22(30)21-12-18(32)9-10-28(21,2)25(19)23(33)14-29(20,3)24(16)26(34)27(35)31-15-17-7-5-4-6-8-17/h4-10,12,16,19-20,22-25,33H,11,13-15H2,1-3H3,(H,31,35)/t16-,19+,20+,22+,23+,24-,25-,28+,29+/m1/s1 |
| InChIKey | XQMXUBRILGXNDS-LLAQVUEFSA-N |
| XLogP | 3.96 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.59 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|