C18H27F3O3 — CID 70558176
(3aR,4S,5R,6aR)-4-[1-hydroxy-4-methyl-4-(trifluoromethyl)oct-1-enyl]-5-methyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 70558176) has the molecular formula C18H27F3O3 and a molecular weight of 348.41 g/mol. Its IUPAC name is (3aR,4S,5R,6aR)-4-[1-hydroxy-4-methyl-4-(trifluoromethyl)oct-1-enyl]-5-methyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,4S,5R,6aR)-4-[1-hydroxy-4-methyl-4-(trifluoromethyl)oct-1-enyl]-5-methyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 70558176 |
| Molecular Formula | C18H27F3O3 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | (3aR,4S,5R,6aR)-4-[1-hydroxy-4-methyl-4-(trifluoromethyl)oct-1-enyl]-5-methyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | CCCCC(C)(CC=C(O)[C@@H]1[C@H]2CC(=O)O[C@@H]2C[C@H]1C)C(F)(F)F |
| InChI | InChI=1S/C18H27F3O3/c1-4-5-7-17(3,18(19,20)21)8-6-13(22)16-11(2)9-14-12(16)10-15(23)24-14/h6,11-12,14,16,22H,4-5,7-10H2,1-3H3/t11-,12+,14-,16+,17?/m1/s1 |
| InChIKey | BYLPCQRUARVFEY-PYEHWJAESA-N |
| XLogP | 5.16 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|