About 1-(2-cyanophenyl)butyl benzoate
1-(2-cyanophenyl)butyl benzoate (PubChem CID 70559394) has the molecular formula C18H17NO2
and a molecular weight of 279.34 g/mol. Its IUPAC name is 1-(2-cyanophenyl)butyl benzoate.
Molecular Properties
| Compound Name | 1-(2-cyanophenyl)butyl benzoate |
| PubChem CID | 70559394 |
| Molecular Formula | C18H17NO2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 1-(2-cyanophenyl)butyl benzoate |
| SMILES | CCCC(OC(=O)c1ccccc1)c1ccccc1C#N |
| InChI | InChI=1S/C18H17NO2/c1-2-8-17(16-12-7-6-11-15(16)13-19)21-18(20)14-9-4-3-5-10-14/h3-7,9-12,17H,2,8H2,1H3 |
| InChIKey | ANYZFYACWTXWCX-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2-cyanophenyl)butyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-cyanophenyl)butyl benzoate?
The IUPAC name of 1-(2-cyanophenyl)butyl benzoate (CID 70559394) is 1-(2-cyanophenyl)butyl benzoate.
What is the SMILES notation for 1-(2-cyanophenyl)butyl benzoate?
The canonical SMILES for 1-(2-cyanophenyl)butyl benzoate is CCCC(OC(=O)c1ccccc1)c1ccccc1C#N.
What is the InChIKey of 1-(2-cyanophenyl)butyl benzoate?
The InChIKey is ANYZFYACWTXWCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17NO2/c1-2-8-17(16-12-7-6-11-15(16)13-19)21-18(20)14-9-4-3-5-10-14/h3-7,9-12,17H,2,8H2,1H3.
What are the key properties of 1-(2-cyanophenyl)butyl benzoate?
1-(2-cyanophenyl)butyl benzoate has a molecular weight of 279.34 g/mol, XLogP of 4.26, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-cyanophenyl)butyl benzoate is sourced from PubChem (CID 70559394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).