C12H14ClNO2 — CID 70563406
1-(8-chloro-9-hydroxy-1,3,4,5-tetrahydro-2-benzazepin-2-yl)ethanone (PubChem CID 70563406) has the molecular formula C12H14ClNO2 and a molecular weight of 239.70 g/mol. Its IUPAC name is 1-(8-chloro-9-hydroxy-1,3,4,5-tetrahydro-2-benzazepin-2-yl)ethanone.
| Compound Name | 1-(8-chloro-9-hydroxy-1,3,4,5-tetrahydro-2-benzazepin-2-yl)ethanone |
|---|---|
| PubChem CID | 70563406 |
| Molecular Formula | C12H14ClNO2 |
| Molecular Weight | 239.70 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 1-(8-chloro-9-hydroxy-1,3,4,5-tetrahydro-2-benzazepin-2-yl)ethanone |
| SMILES | CC(=O)N1CCCc2ccc(Cl)c(O)c2C1 |
| InChI | InChI=1S/C12H14ClNO2/c1-8(15)14-6-2-3-9-4-5-11(13)12(16)10(9)7-14/h4-5,16H,2-3,6-7H2,1H3 |
| InChIKey | GILVWKUCKBQNTN-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.70 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|