C19H26NO3S+ — CID 7057173
[(2S)-2-hydroxy-3-[2-(3-phenylpropanoyl)thiophen-3-yl]oxypropyl]-propylazanium (PubChem CID 7057173) has the molecular formula C19H26NO3S+ and a molecular weight of 348.49 g/mol. Its IUPAC name is [(2S)-2-hydroxy-3-[2-(3-phenylpropanoyl)thiophen-3-yl]oxypropyl]-propylazanium.
| Compound Name | [(2S)-2-hydroxy-3-[2-(3-phenylpropanoyl)thiophen-3-yl]oxypropyl]-propylazanium |
|---|---|
| PubChem CID | 7057173 |
| Molecular Formula | C19H26NO3S+ |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | [(2S)-2-hydroxy-3-[2-(3-phenylpropanoyl)thiophen-3-yl]oxypropyl]-propylazanium |
| SMILES | CCC[NH2+]C[C@H](O)COc1ccsc1C(=O)CCc1ccccc1 |
| InChI | InChI=1S/C19H25NO3S/c1-2-11-20-13-16(21)14-23-18-10-12-24-19(18)17(22)9-8-15-6-4-3-5-7-15/h3-7,10,12,16,20-21H,2,8-9,11,13-14H2,1H3/p+1/t16-/m0/s1 |
| InChIKey | QRTLOSXXNXCUKQ-INIZCTEOSA-O |
| XLogP | 2.28 |
| TPSA | 63.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|