C19H24N2O2S — CID 70574408
N-[2-[[3-(aminomethyl)-2,6-dimethylphenyl]methylsulfanyl]ethyl]-2-hydroxybenzamide (PubChem CID 70574408) has the molecular formula C19H24N2O2S and a molecular weight of 344.48 g/mol. Its IUPAC name is N-[2-[[3-(aminomethyl)-2,6-dimethylphenyl]methylsulfanyl]ethyl]-2-hydroxybenzamide.
| Compound Name | N-[2-[[3-(aminomethyl)-2,6-dimethylphenyl]methylsulfanyl]ethyl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 70574408 |
| Molecular Formula | C19H24N2O2S |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | N-[2-[[3-(aminomethyl)-2,6-dimethylphenyl]methylsulfanyl]ethyl]-2-hydroxybenzamide |
| SMILES | Cc1ccc(CN)c(C)c1CSCCNC(=O)c1ccccc1O |
| InChI | InChI=1S/C19H24N2O2S/c1-13-7-8-15(11-20)14(2)17(13)12-24-10-9-21-19(23)16-5-3-4-6-18(16)22/h3-8,22H,9-12,20H2,1-2H3,(H,21,23) |
| InChIKey | DAPPOBQGIACFEZ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|