C9H8Cl4O2 — CID 7057470
(1R,5S)-2,2,4,4-tetrachloro-1,5-dimethyl-8-oxabicyclo[3.2.1]oct-6-en-3-one (PubChem CID 7057470) has the molecular formula C9H8Cl4O2 and a molecular weight of 289.97 g/mol. Its IUPAC name is (1R,5S)-2,2,4,4-tetrachloro-1,5-dimethyl-8-oxabicyclo[3.2.1]oct-6-en-3-one.
| Compound Name | (1R,5S)-2,2,4,4-tetrachloro-1,5-dimethyl-8-oxabicyclo[3.2.1]oct-6-en-3-one |
|---|---|
| PubChem CID | 7057470 |
| Molecular Formula | C9H8Cl4O2 |
| Molecular Weight | 289.97 g/mol |
| Exact Mass | 287.93 |
| IUPAC Name | (1R,5S)-2,2,4,4-tetrachloro-1,5-dimethyl-8-oxabicyclo[3.2.1]oct-6-en-3-one |
| SMILES | C[C@]12C=C[C@](C)(O1)C(Cl)(Cl)C(=O)C2(Cl)Cl |
| InChI | InChI=1S/C9H8Cl4O2/c1-6-3-4-7(2,15-6)9(12,13)5(14)8(6,10)11/h3-4H,1-2H3/t6-,7+ |
| InChIKey | GQRXCDWGIODASE-KNVOCYPGSA-N |
| XLogP | 3.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.97 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|