C21H25IO3 — CID 70579696
5-(6-iodohex-3-enyl)-1,3-dimethoxy-2-phenylmethoxybenzene (PubChem CID 70579696) has the molecular formula C21H25IO3 and a molecular weight of 452.33 g/mol. Its IUPAC name is 5-(6-iodohex-3-enyl)-1,3-dimethoxy-2-phenylmethoxybenzene.
| Compound Name | 5-(6-iodohex-3-enyl)-1,3-dimethoxy-2-phenylmethoxybenzene |
|---|---|
| PubChem CID | 70579696 |
| Molecular Formula | C21H25IO3 |
| Molecular Weight | 452.33 g/mol |
| Exact Mass | 452.08 |
| IUPAC Name | 5-(6-iodohex-3-enyl)-1,3-dimethoxy-2-phenylmethoxybenzene |
| SMILES | COc1cc(CCC=CCCI)cc(OC)c1OCc1ccccc1 |
| InChI | InChI=1S/C21H25IO3/c1-23-19-14-18(12-6-3-4-9-13-22)15-20(24-2)21(19)25-16-17-10-7-5-8-11-17/h3-5,7-8,10-11,14-15H,6,9,12-13,16H2,1-2H3 |
| InChIKey | NINJWWLVKRQPLS-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.33 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|