C31H25N5O8 — CID 70579938
[(2R,3R,4R,5R)-5-(2-amino-4-oxoimidazo[1,2-a][1,3,5]triazin-8-yl)-3,4-dibenzoyloxyoxolan-2-yl]methyl benzoate (PubChem CID 70579938) has the molecular formula C31H25N5O8 and a molecular weight of 595.57 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(2-amino-4-oxoimidazo[1,2-a][1,3,5]triazin-8-yl)-3,4-dibenzoyloxyoxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4R,5R)-5-(2-amino-4-oxoimidazo[1,2-a][1,3,5]triazin-8-yl)-3,4-dibenzoyloxyoxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 70579938 |
| Molecular Formula | C31H25N5O8 |
| Molecular Weight | 595.57 g/mol |
| Exact Mass | 595.17 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(2-amino-4-oxoimidazo[1,2-a][1,3,5]triazin-8-yl)-3,4-dibenzoyloxyoxolan-2-yl]methyl benzoate |
| SMILES | Nc1nc(=O)n2ccn([C@@H]3O[C@H](COC(=O)c4ccccc4)[C@@H](OC(=O)c4ccccc4)[C@H]3OC(=O)c3ccccc3)c2n1 |
| InChI | InChI=1S/C31H25N5O8/c32-29-33-30-35(16-17-36(30)31(40)34-29)25-24(44-28(39)21-14-8-3-9-15-21)23(43-27(38)20-12-6-2-7-13-20)22(42-25)18-41-26(37)19-10-4-1-5-11-19/h1-17,22-25H,18H2,(H2,32,34,40)/t22-,23-,24-,25-/m1/s1 |
| InChIKey | BWDTVZCOYGGRAE-ZGFBMJKBSA-N |
| XLogP | 2.68 |
| TPSA | 166.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.57 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|