C12H12O4 — CID 70581547
4-ethyl-2-hydroxy-2-(hydroxymethyl)indene-1,3-dione (PubChem CID 70581547) has the molecular formula C12H12O4 and a molecular weight of 220.22 g/mol. Its IUPAC name is 4-ethyl-2-hydroxy-2-(hydroxymethyl)indene-1,3-dione.
| Compound Name | 4-ethyl-2-hydroxy-2-(hydroxymethyl)indene-1,3-dione |
|---|---|
| PubChem CID | 70581547 |
| Molecular Formula | C12H12O4 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 4-ethyl-2-hydroxy-2-(hydroxymethyl)indene-1,3-dione |
| SMILES | CCc1cccc2c1C(=O)C(O)(CO)C2=O |
| InChI | InChI=1S/C12H12O4/c1-2-7-4-3-5-8-9(7)11(15)12(16,6-13)10(8)14/h3-5,13,16H,2,6H2,1H3 |
| InChIKey | GFLZADCJMMZTBT-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|