C23H26BrCl2FO7 — CID 70581999
4-[(8S,9R,10S,13S,14S,17S)-2-bromo-9,11-dichloro-6-fluoro-16,17-dihydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-3-hydroxy-4-oxobutanoic acid (PubChem CID 70581999) has the molecular formula C23H26BrCl2FO7 and a molecular weight of 584.26 g/mol. Its IUPAC name is 4-[(8S,9R,10S,13S,14S,17S)-2-bromo-9,11-dichloro-6-fluoro-16,17-dihydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-3-hydroxy-4-oxobutanoic acid.
| Compound Name | 4-[(8S,9R,10S,13S,14S,17S)-2-bromo-9,11-dichloro-6-fluoro-16,17-dihydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-3-hydroxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 70581999 |
| Molecular Formula | C23H26BrCl2FO7 |
| Molecular Weight | 584.26 g/mol |
| Exact Mass | 582.02 |
| IUPAC Name | 4-[(8S,9R,10S,13S,14S,17S)-2-bromo-9,11-dichloro-6-fluoro-16,17-dihydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-3-hydroxy-4-oxobutanoic acid |
| SMILES | C[C@]12C=C(Br)C(=O)C=C1C(F)C[C@H]1[C@@H]3CC(O)[C@](O)(C(=O)C(O)CC(=O)O)[C@@]3(C)CC(Cl)[C@@]12Cl |
| InChI | InChI=1S/C23H26BrCl2FO7/c1-20-7-12(24)14(28)4-11(20)13(27)3-10-9-5-17(30)23(34,19(33)15(29)6-18(31)32)21(9,2)8-16(25)22(10,20)26/h4,7,9-10,13,15-17,29-30,34H,3,5-6,8H2,1-2H3,(H,31,32)/t9-,10-,13?,15?,16?,17?,20-,21-,22-,23-/m0/s1 |
| InChIKey | RTYCIYINKXAMIJ-RSXMRTBWSA-N |
| XLogP | 2.65 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.26 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|