C22H24Cl5FO3 — CID 88798893
(8S,9R,10S,13S,14S,17R)-4,9,11-trichloro-17-(2,2-dichloroacetyl)-6-fluoro-17-hydroxy-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one (PubChem CID 88798893) has the molecular formula C22H24Cl5FO3 and a molecular weight of 532.69 g/mol. Its IUPAC name is (8S,9R,10S,13S,14S,17R)-4,9,11-trichloro-17-(2,2-dichloroacetyl)-6-fluoro-17-hydroxy-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9R,10S,13S,14S,17R)-4,9,11-trichloro-17-(2,2-dichloroacetyl)-6-fluoro-17-hydroxy-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 88798893 |
| Molecular Formula | C22H24Cl5FO3 |
| Molecular Weight | 532.69 g/mol |
| Exact Mass | 530.02 |
| IUPAC Name | (8S,9R,10S,13S,14S,17R)-4,9,11-trichloro-17-(2,2-dichloroacetyl)-6-fluoro-17-hydroxy-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC1C[C@H]2[C@@H]3CC(F)C4=C(Cl)C(=O)C=C[C@]4(C)[C@@]3(Cl)C(Cl)C[C@]2(C)[C@@]1(O)C(=O)C(Cl)Cl |
| InChI | InChI=1S/C22H24Cl5FO3/c1-9-6-10-11-7-12(28)15-16(24)13(29)4-5-19(15,2)21(11,27)14(23)8-20(10,3)22(9,31)17(30)18(25)26/h4-5,9-12,14,18,31H,6-8H2,1-3H3/t9?,10-,11-,12?,14?,19-,20-,21-,22-/m0/s1 |
| InChIKey | NGIGNMWYHXXZQE-XTQNPZSJSA-N |
| XLogP | 5.74 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.69 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|