C24H28Cl2F2O4S — CID 22815457
[(6S,8S,9R,10S,11S,13S,14S,16S,17R)-9,11-dichloro-4,6-difluoro-17-methoxycarbothioyl-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 22815457) has the molecular formula C24H28Cl2F2O4S and a molecular weight of 521.45 g/mol. Its IUPAC name is [(6S,8S,9R,10S,11S,13S,14S,16S,17R)-9,11-dichloro-4,6-difluoro-17-methoxycarbothioyl-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(6S,8S,9R,10S,11S,13S,14S,16S,17R)-9,11-dichloro-4,6-difluoro-17-methoxycarbothioyl-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 22815457 |
| Molecular Formula | C24H28Cl2F2O4S |
| Molecular Weight | 521.45 g/mol |
| Exact Mass | 520.11 |
| IUPAC Name | [(6S,8S,9R,10S,11S,13S,14S,16S,17R)-9,11-dichloro-4,6-difluoro-17-methoxycarbothioyl-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | COC(=S)[C@@]1(OC(C)=O)[C@@H](C)C[C@H]2[C@@H]3C[C@H](F)C4=C(F)C(=O)C=C[C@]4(C)[C@@]3(Cl)[C@@H](Cl)C[C@@]21C |
| InChI | InChI=1S/C24H28Cl2F2O4S/c1-11-8-13-14-9-15(27)18-19(28)16(30)6-7-21(18,3)23(14,26)17(25)10-22(13,4)24(11,20(33)31-5)32-12(2)29/h6-7,11,13-15,17H,8-10H2,1-5H3/t11-,13-,14-,15-,17-,21-,22-,23-,24-/m0/s1 |
| InChIKey | XQXCIYJMYYGPTQ-YYPCDCRVSA-N |
| XLogP | 5.64 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.45 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|