C22H26Cl2F2O3 — CID 70571940
(6S,8S,9R,10S,11S,13S,14S,16R,17R)-17-acetyl-9,11-dichloro-4,6-difluoro-17-hydroxy-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one (PubChem CID 70571940) has the molecular formula C22H26Cl2F2O3 and a molecular weight of 447.35 g/mol. Its IUPAC name is (6S,8S,9R,10S,11S,13S,14S,16R,17R)-17-acetyl-9,11-dichloro-4,6-difluoro-17-hydroxy-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (6S,8S,9R,10S,11S,13S,14S,16R,17R)-17-acetyl-9,11-dichloro-4,6-difluoro-17-hydroxy-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 70571940 |
| Molecular Formula | C22H26Cl2F2O3 |
| Molecular Weight | 447.35 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | (6S,8S,9R,10S,11S,13S,14S,16R,17R)-17-acetyl-9,11-dichloro-4,6-difluoro-17-hydroxy-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC(=O)[C@@]1(O)[C@H](C)C[C@H]2[C@@H]3C[C@H](F)C4=C(F)C(=O)C=C[C@]4(C)[C@@]3(Cl)[C@@H](Cl)C[C@@]21C |
| InChI | InChI=1S/C22H26Cl2F2O3/c1-10-7-12-13-8-14(25)17-18(26)15(28)5-6-19(17,3)21(13,24)16(23)9-20(12,4)22(10,29)11(2)27/h5-6,10,12-14,16,29H,7-9H2,1-4H3/t10-,12+,13+,14+,16+,19+,20+,21+,22+/m1/s1 |
| InChIKey | SVKAINQFMAUGNK-HRGDYILZSA-N |
| XLogP | 4.68 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.35 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|