C16H16N2 — CID 70582958
3-amino-2,3-diphenylbutanenitrile (PubChem CID 70582958) has the molecular formula C16H16N2 and a molecular weight of 236.32 g/mol. Its IUPAC name is 3-amino-2,3-diphenylbutanenitrile.
| Compound Name | 3-amino-2,3-diphenylbutanenitrile |
|---|---|
| PubChem CID | 70582958 |
| Molecular Formula | C16H16N2 |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 3-amino-2,3-diphenylbutanenitrile |
| SMILES | CC(N)(c1ccccc1)C(C#N)c1ccccc1 |
| InChI | InChI=1S/C16H16N2/c1-16(18,14-10-6-3-7-11-14)15(12-17)13-8-4-2-5-9-13/h2-11,15H,18H2,1H3 |
| InChIKey | LGCMDVQPROHOPK-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |