C33H31NO6 — CID 70584229
ethyl N-[1,2-bis[4-(2-methylbenzoyl)phenoxy]ethyl]carbamate (PubChem CID 70584229) has the molecular formula C33H31NO6 and a molecular weight of 537.61 g/mol. Its IUPAC name is ethyl N-[1,2-bis[4-(2-methylbenzoyl)phenoxy]ethyl]carbamate.
| Compound Name | ethyl N-[1,2-bis[4-(2-methylbenzoyl)phenoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 70584229 |
| Molecular Formula | C33H31NO6 |
| Molecular Weight | 537.61 g/mol |
| Exact Mass | 537.22 |
| IUPAC Name | ethyl N-[1,2-bis[4-(2-methylbenzoyl)phenoxy]ethyl]carbamate |
| SMILES | CCOC(=O)NC(COc1ccc(C(=O)c2ccccc2C)cc1)Oc1ccc(C(=O)c2ccccc2C)cc1 |
| InChI | InChI=1S/C33H31NO6/c1-4-38-33(37)34-30(40-27-19-15-25(16-20-27)32(36)29-12-8-6-10-23(29)3)21-39-26-17-13-24(14-18-26)31(35)28-11-7-5-9-22(28)2/h5-20,30H,4,21H2,1-3H3,(H,34,37) |
| InChIKey | LZSLXUKZPKJFKL-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.61 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|