C25H38O3 — CID 70587008
bis(1-hexan-3-yloxycyclohexa-2,4-dien-1-yl)methanone (PubChem CID 70587008) has the molecular formula C25H38O3 and a molecular weight of 386.58 g/mol. Its IUPAC name is bis(1-hexan-3-yloxycyclohexa-2,4-dien-1-yl)methanone.
| Compound Name | bis(1-hexan-3-yloxycyclohexa-2,4-dien-1-yl)methanone |
|---|---|
| PubChem CID | 70587008 |
| Molecular Formula | C25H38O3 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.28 |
| IUPAC Name | bis(1-hexan-3-yloxycyclohexa-2,4-dien-1-yl)methanone |
| SMILES | CCCC(CC)OC1(C(=O)C2(OC(CC)CCC)C=CC=CC2)C=CC=CC1 |
| InChI | InChI=1S/C25H38O3/c1-5-15-21(7-3)27-24(17-11-9-12-18-24)23(26)25(19-13-10-14-20-25)28-22(8-4)16-6-2/h9-14,17,19,21-22H,5-8,15-16,18,20H2,1-4H3 |
| InChIKey | DLJDNJKQXIFIFE-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |