C13H18O — CID 70589965
1-ethenyl-7-methylidene-1,3,4,4a,5,6,8,8a-octahydronaphthalen-2-one (PubChem CID 70589965) has the molecular formula C13H18O and a molecular weight of 190.29 g/mol. Its IUPAC name is 1-ethenyl-7-methylidene-1,3,4,4a,5,6,8,8a-octahydronaphthalen-2-one.
| Compound Name | 1-ethenyl-7-methylidene-1,3,4,4a,5,6,8,8a-octahydronaphthalen-2-one |
|---|---|
| PubChem CID | 70589965 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | 1-ethenyl-7-methylidene-1,3,4,4a,5,6,8,8a-octahydronaphthalen-2-one |
| SMILES | C=CC1C(=O)CCC2CCC(=C)CC21 |
| InChI | InChI=1S/C13H18O/c1-3-11-12-8-9(2)4-5-10(12)6-7-13(11)14/h3,10-12H,1-2,4-8H2 |
| InChIKey | GNVLLKFQIHTBES-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|