C11H14O2 — CID 131197342
(3aS,7R,7aS)-7-ethenyl-3,3a,4,6,7,7a-hexahydro-2H-indene-1,5-dione (PubChem CID 131197342) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is (3aS,7R,7aS)-7-ethenyl-3,3a,4,6,7,7a-hexahydro-2H-indene-1,5-dione.
| Compound Name | (3aS,7R,7aS)-7-ethenyl-3,3a,4,6,7,7a-hexahydro-2H-indene-1,5-dione |
|---|---|
| PubChem CID | 131197342 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | (3aS,7R,7aS)-7-ethenyl-3,3a,4,6,7,7a-hexahydro-2H-indene-1,5-dione |
| SMILES | C=C[C@H]1CC(=O)C[C@@H]2CCC(=O)[C@@H]21 |
| InChI | InChI=1S/C11H14O2/c1-2-7-5-9(12)6-8-3-4-10(13)11(7)8/h2,7-8,11H,1,3-6H2/t7-,8-,11+/m0/s1 |
| InChIKey | MPJZLXVABGVFGD-DKCNOQQISA-N |
| XLogP | 1.75 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|