C11H14O2 — CID 130914773
(3aR,6aR)-1-prop-2-enyl-1,3,3a,4,6,6a-hexahydropentalene-2,5-dione (PubChem CID 130914773) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is (3aR,6aR)-1-prop-2-enyl-1,3,3a,4,6,6a-hexahydropentalene-2,5-dione.
| Compound Name | (3aR,6aR)-1-prop-2-enyl-1,3,3a,4,6,6a-hexahydropentalene-2,5-dione |
|---|---|
| PubChem CID | 130914773 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | (3aR,6aR)-1-prop-2-enyl-1,3,3a,4,6,6a-hexahydropentalene-2,5-dione |
| SMILES | C=CCC1C(=O)C[C@H]2CC(=O)C[C@@H]12 |
| InChI | InChI=1S/C11H14O2/c1-2-3-9-10-6-8(12)4-7(10)5-11(9)13/h2,7,9-10H,1,3-6H2/t7-,9?,10-/m1/s1 |
| InChIKey | APDRVVCGORUSBN-DJROOOTPSA-N |
| XLogP | 1.75 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|