C18H19NO4 — CID 70598523
2-[4-[(3-hydroxy-2-phenylpropanoyl)amino]phenyl]propanoic acid (PubChem CID 70598523) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is 2-[4-[(3-hydroxy-2-phenylpropanoyl)amino]phenyl]propanoic acid.
| Compound Name | 2-[4-[(3-hydroxy-2-phenylpropanoyl)amino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 70598523 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 2-[4-[(3-hydroxy-2-phenylpropanoyl)amino]phenyl]propanoic acid |
| SMILES | CC(C(=O)O)c1ccc(NC(=O)C(CO)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H19NO4/c1-12(18(22)23)13-7-9-15(10-8-13)19-17(21)16(11-20)14-5-3-2-4-6-14/h2-10,12,16,20H,11H2,1H3,(H,19,21)(H,22,23) |
| InChIKey | HPAKYMPLQZSEEK-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |