C13H20N4O3 — CID 7059881
1,3-dimethyl-5-(piperidin-4-ylmethyliminomethyl)-1,3-diazinane-2,4,6-trione (PubChem CID 7059881) has the molecular formula C13H20N4O3 and a molecular weight of 280.33 g/mol. Its IUPAC name is 1,3-dimethyl-5-(piperidin-4-ylmethyliminomethyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 1,3-dimethyl-5-(piperidin-4-ylmethyliminomethyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 7059881 |
| Molecular Formula | C13H20N4O3 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 1,3-dimethyl-5-(piperidin-4-ylmethyliminomethyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CN1C(=O)C(/C=N/CC2CCNCC2)C(=O)N(C)C1=O |
| InChI | InChI=1S/C13H20N4O3/c1-16-11(18)10(12(19)17(2)13(16)20)8-15-7-9-3-5-14-6-4-9/h8-10,14H,3-7H2,1-2H3/b15-8+ |
| InChIKey | TUIAVALOXMFMTD-OVCLIPMQSA-N |
| XLogP | -0.28 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|