C16H27N4O3+ — CID 7059764
1,3-dimethyl-5-[(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)iminomethyl]-1,3-diazinane-2,4,6-trione (PubChem CID 7059764) has the molecular formula C16H27N4O3+ and a molecular weight of 323.42 g/mol. Its IUPAC name is 1,3-dimethyl-5-[(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)iminomethyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 1,3-dimethyl-5-[(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)iminomethyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 7059764 |
| Molecular Formula | C16H27N4O3+ |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | 1,3-dimethyl-5-[(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)iminomethyl]-1,3-diazinane-2,4,6-trione |
| SMILES | CN1C(=O)C(/C=N/C2CC(C)(C)[NH2+]C(C)(C)C2)C(=O)N(C)C1=O |
| InChI | InChI=1S/C16H26N4O3/c1-15(2)7-10(8-16(3,4)18-15)17-9-11-12(21)19(5)14(23)20(6)13(11)22/h9-11,18H,7-8H2,1-6H3/p+1/b17-9+ |
| InChIKey | LZTGSFOVNBKDPJ-RQZCQDPDSA-O |
| XLogP | 0.01 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|