C17H18ClN3O6 — CID 70598963
5-[2-[[2-(4-chloro-3-nitrophenyl)-2-hydroxyethyl]amino]ethoxy]-2-hydroxybenzamide (PubChem CID 70598963) has the molecular formula C17H18ClN3O6 and a molecular weight of 395.80 g/mol. Its IUPAC name is 5-[2-[[2-(4-chloro-3-nitrophenyl)-2-hydroxyethyl]amino]ethoxy]-2-hydroxybenzamide.
| Compound Name | 5-[2-[[2-(4-chloro-3-nitrophenyl)-2-hydroxyethyl]amino]ethoxy]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 70598963 |
| Molecular Formula | C17H18ClN3O6 |
| Molecular Weight | 395.80 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | 5-[2-[[2-(4-chloro-3-nitrophenyl)-2-hydroxyethyl]amino]ethoxy]-2-hydroxybenzamide |
| SMILES | NC(=O)c1cc(OCCNCC(O)c2ccc(Cl)c([N+](=O)[O-])c2)ccc1O |
| InChI | InChI=1S/C17H18ClN3O6/c18-13-3-1-10(7-14(13)21(25)26)16(23)9-20-5-6-27-11-2-4-15(22)12(8-11)17(19)24/h1-4,7-8,16,20,22-23H,5-6,9H2,(H2,19,24) |
| InChIKey | SAVYSZPAELPICI-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 147.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.80 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|