C20H28ClNO — CID 70599187
[4-hydroxy-4-(2-phenylphenyl)butyl]-methyl-propan-2-ylazanium chloride (PubChem CID 70599187) has the molecular formula C20H28ClNO and a molecular weight of 333.90 g/mol. Its IUPAC name is [4-hydroxy-4-(2-phenylphenyl)butyl]-methyl-propan-2-ylazanium chloride.
| Compound Name | [4-hydroxy-4-(2-phenylphenyl)butyl]-methyl-propan-2-ylazanium chloride |
|---|---|
| PubChem CID | 70599187 |
| Molecular Formula | C20H28ClNO |
| Molecular Weight | 333.90 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | [4-hydroxy-4-(2-phenylphenyl)butyl]-methyl-propan-2-ylazanium chloride |
| SMILES | CC(C)[NH+](C)CCCC(O)c1ccccc1-c1ccccc1.[Cl-] |
| InChI | InChI=1S/C20H27NO.ClH/c1-16(2)21(3)15-9-14-20(22)19-13-8-7-12-18(19)17-10-5-4-6-11-17;/h4-8,10-13,16,20,22H,9,14-15H2,1-3H3;1H |
| InChIKey | DQUHCCAEFWTUIR-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 24.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.90 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |