C24H27Cl2NO5 — CID 70599608
(E)-but-2-enedioic acid;2-[4-[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]phenyl]ethanol (PubChem CID 70599608) has the molecular formula C24H27Cl2NO5 and a molecular weight of 480.39 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;2-[4-[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]phenyl]ethanol.
| Compound Name | (E)-but-2-enedioic acid;2-[4-[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]phenyl]ethanol |
|---|---|
| PubChem CID | 70599608 |
| Molecular Formula | C24H27Cl2NO5 |
| Molecular Weight | 480.39 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | (E)-but-2-enedioic acid;2-[4-[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]phenyl]ethanol |
| SMILES | O=C(O)/C=C/C(=O)O.OCCc1ccc(C2CCN(Cc3ccc(Cl)c(Cl)c3)CC2)cc1 |
| InChI | InChI=1S/C20H23Cl2NO.C4H4O4/c21-19-6-3-16(13-20(19)22)14-23-10-7-18(8-11-23)17-4-1-15(2-5-17)9-12-24;5-3(6)1-2-4(7)8/h1-6,13,18,24H,7-12,14H2;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | ZQBLXBLREOZKDG-WLHGVMLRSA-N |
| XLogP | 4.62 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.39 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|