C19H23Cl2NO — CID 70600488
2,6-dichloro-4-cyclohexylphenol;phenylmethanamine (PubChem CID 70600488) has the molecular formula C19H23Cl2NO and a molecular weight of 352.31 g/mol. Its IUPAC name is 2,6-dichloro-4-cyclohexylphenol;phenylmethanamine.
| Compound Name | 2,6-dichloro-4-cyclohexylphenol;phenylmethanamine |
|---|---|
| PubChem CID | 70600488 |
| Molecular Formula | C19H23Cl2NO |
| Molecular Weight | 352.31 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 2,6-dichloro-4-cyclohexylphenol;phenylmethanamine |
| SMILES | NCc1ccccc1.Oc1c(Cl)cc(C2CCCCC2)cc1Cl |
| InChI | InChI=1S/C12H14Cl2O.C7H9N/c13-10-6-9(7-11(14)12(10)15)8-4-2-1-3-5-8;8-6-7-4-2-1-3-5-7/h6-8,15H,1-5H2;1-5H,6,8H2 |
| InChIKey | PGWHTABXVJPVPM-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.31 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |