C18H26O4 — CID 70601829
7-[(1S,2R)-2-(3-hydroxycyclohexen-1-yl)-5-oxocyclopentyl]hept-5-enoic acid (PubChem CID 70601829) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is 7-[(1S,2R)-2-(3-hydroxycyclohexen-1-yl)-5-oxocyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1S,2R)-2-(3-hydroxycyclohexen-1-yl)-5-oxocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70601829 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 7-[(1S,2R)-2-(3-hydroxycyclohexen-1-yl)-5-oxocyclopentyl]hept-5-enoic acid |
| SMILES | O=C(O)CCCC=CC[C@@H]1C(=O)CC[C@H]1C1=CC(O)CCC1 |
| InChI | InChI=1S/C18H26O4/c19-14-7-5-6-13(12-14)15-10-11-17(20)16(15)8-3-1-2-4-9-18(21)22/h1,3,12,14-16,19H,2,4-11H2,(H,21,22)/t14?,15-,16-/m0/s1 |
| InChIKey | VHXUEEPEVPHNIC-YVZMLIKISA-N |
| XLogP | 3.25 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|