C45H36N2O9 — CID 70603741
bis[4-[1-[4-(1,3-benzoxazol-2-yl)phenoxy]propan-2-yloxy]-2-hydroxyphenyl]methanone (PubChem CID 70603741) has the molecular formula C45H36N2O9 and a molecular weight of 748.79 g/mol. Its IUPAC name is bis[4-[1-[4-(1,3-benzoxazol-2-yl)phenoxy]propan-2-yloxy]-2-hydroxyphenyl]methanone.
| Compound Name | bis[4-[1-[4-(1,3-benzoxazol-2-yl)phenoxy]propan-2-yloxy]-2-hydroxyphenyl]methanone |
|---|---|
| PubChem CID | 70603741 |
| Molecular Formula | C45H36N2O9 |
| Molecular Weight | 748.79 g/mol |
| Exact Mass | 748.24 |
| IUPAC Name | bis[4-[1-[4-(1,3-benzoxazol-2-yl)phenoxy]propan-2-yloxy]-2-hydroxyphenyl]methanone |
| SMILES | CC(COc1ccc(-c2nc3ccccc3o2)cc1)Oc1ccc(C(=O)c2ccc(OC(C)COc3ccc(-c4nc5ccccc5o4)cc3)cc2O)c(O)c1 |
| InChI | InChI=1S/C45H36N2O9/c1-27(25-51-31-15-11-29(12-16-31)44-46-37-7-3-5-9-41(37)55-44)53-33-19-21-35(39(48)23-33)43(50)36-22-20-34(24-40(36)49)54-28(2)26-52-32-17-13-30(14-18-32)45-47-38-8-4-6-10-42(38)56-45/h3-24,27-28,48-49H,25-26H2,1-2H3 |
| InChIKey | QHRODDGMGQYQTF-UHFFFAOYSA-N |
| XLogP | 9.64 |
| TPSA | 146.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.79 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |