C20H19NO — CID 70608864
10-amino-1,10-bis(prop-2-enyl)anthracen-9-one (PubChem CID 70608864) has the molecular formula C20H19NO and a molecular weight of 289.38 g/mol. Its IUPAC name is 10-amino-1,10-bis(prop-2-enyl)anthracen-9-one.
| Compound Name | 10-amino-1,10-bis(prop-2-enyl)anthracen-9-one |
|---|---|
| PubChem CID | 70608864 |
| Molecular Formula | C20H19NO |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 10-amino-1,10-bis(prop-2-enyl)anthracen-9-one |
| SMILES | C=CCc1cccc2c1C(=O)c1ccccc1C2(N)CC=C |
| InChI | InChI=1S/C20H19NO/c1-3-8-14-9-7-12-17-18(14)19(22)15-10-5-6-11-16(15)20(17,21)13-4-2/h3-7,9-12H,1-2,8,13,21H2 |
| InChIKey | SODSXXMVZYIRNT-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|