C18H19NO3 — CID 70613604
1-(3,4-dihydroxyphenyl)-2-(1-phenylbut-3-enylamino)ethanone (PubChem CID 70613604) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is 1-(3,4-dihydroxyphenyl)-2-(1-phenylbut-3-enylamino)ethanone.
| Compound Name | 1-(3,4-dihydroxyphenyl)-2-(1-phenylbut-3-enylamino)ethanone |
|---|---|
| PubChem CID | 70613604 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 1-(3,4-dihydroxyphenyl)-2-(1-phenylbut-3-enylamino)ethanone |
| SMILES | C=CCC(NCC(=O)c1ccc(O)c(O)c1)c1ccccc1 |
| InChI | InChI=1S/C18H19NO3/c1-2-6-15(13-7-4-3-5-8-13)19-12-18(22)14-9-10-16(20)17(21)11-14/h2-5,7-11,15,19-21H,1,6,12H2 |
| InChIKey | RREQBQNSIYLGCN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|