C17H14O3 — CID 67570155
1-(3-ethenyl-4-hydroxyphenyl)-3-phenylpropane-1,3-dione (PubChem CID 67570155) has the molecular formula C17H14O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is 1-(3-ethenyl-4-hydroxyphenyl)-3-phenylpropane-1,3-dione.
| Compound Name | 1-(3-ethenyl-4-hydroxyphenyl)-3-phenylpropane-1,3-dione |
|---|---|
| PubChem CID | 67570155 |
| Molecular Formula | C17H14O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 1-(3-ethenyl-4-hydroxyphenyl)-3-phenylpropane-1,3-dione |
| SMILES | C=Cc1cc(C(=O)CC(=O)c2ccccc2)ccc1O |
| InChI | InChI=1S/C17H14O3/c1-2-12-10-14(8-9-15(12)18)17(20)11-16(19)13-6-4-3-5-7-13/h2-10,18H,1,11H2 |
| InChIKey | YCIKDCHQVFEZSQ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|