C20H38O — CID 70617400
(2R,3S)-3-[(Z)-hept-3-enyl]-2-octyloxane (PubChem CID 70617400) has the molecular formula C20H38O and a molecular weight of 294.52 g/mol. Its IUPAC name is (2R,3S)-3-[(Z)-hept-3-enyl]-2-octyloxane.
| Compound Name | (2R,3S)-3-[(Z)-hept-3-enyl]-2-octyloxane |
|---|---|
| PubChem CID | 70617400 |
| Molecular Formula | C20H38O |
| Molecular Weight | 294.52 g/mol |
| Exact Mass | 294.29 |
| IUPAC Name | (2R,3S)-3-[(Z)-hept-3-enyl]-2-octyloxane |
| SMILES | CCC/C=C\CC[C@H]1CCCO[C@@H]1CCCCCCCC |
| InChI | InChI=1S/C20H38O/c1-3-5-7-9-11-13-17-20-19(16-14-18-21-20)15-12-10-8-6-4-2/h8,10,19-20H,3-7,9,11-18H2,1-2H3/b10-8-/t19-,20+/m0/s1 |
| InChIKey | DTFILNJGGYKUOM-SJGBYXOVSA-N |
| XLogP | 6.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.52 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|