C31H35NO9 — CID 70620129
oxalic acid;2-(4-phenylpiperidin-1-yl)ethyl 2,3-dihydroxy-2-[hydroxy(phenyl)methyl]-3-phenylpropanoate (PubChem CID 70620129) has the molecular formula C31H35NO9 and a molecular weight of 565.62 g/mol. Its IUPAC name is oxalic acid;2-(4-phenylpiperidin-1-yl)ethyl 2,3-dihydroxy-2-[hydroxy(phenyl)methyl]-3-phenylpropanoate.
| Compound Name | oxalic acid;2-(4-phenylpiperidin-1-yl)ethyl 2,3-dihydroxy-2-[hydroxy(phenyl)methyl]-3-phenylpropanoate |
|---|---|
| PubChem CID | 70620129 |
| Molecular Formula | C31H35NO9 |
| Molecular Weight | 565.62 g/mol |
| Exact Mass | 565.23 |
| IUPAC Name | oxalic acid;2-(4-phenylpiperidin-1-yl)ethyl 2,3-dihydroxy-2-[hydroxy(phenyl)methyl]-3-phenylpropanoate |
| SMILES | O=C(O)C(=O)O.O=C(OCCN1CCC(c2ccccc2)CC1)C(O)(C(O)c1ccccc1)C(O)c1ccccc1 |
| InChI | InChI=1S/C29H33NO5.C2H2O4/c31-26(24-12-6-2-7-13-24)29(34,27(32)25-14-8-3-9-15-25)28(33)35-21-20-30-18-16-23(17-19-30)22-10-4-1-5-11-22;3-1(4)2(5)6/h1-15,23,26-27,31-32,34H,16-21H2;(H,3,4)(H,5,6) |
| InChIKey | QXKOLMFCHYYXLX-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 164.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.62 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|