C24H33N3O5 — CID 66608253
1-[2-(1-cyclohexylpyrazol-3-yl)oxyethyl]-4-phenylpiperidine;oxalic acid (PubChem CID 66608253) has the molecular formula C24H33N3O5 and a molecular weight of 443.54 g/mol. Its IUPAC name is 1-[2-(1-cyclohexylpyrazol-3-yl)oxyethyl]-4-phenylpiperidine;oxalic acid.
| Compound Name | 1-[2-(1-cyclohexylpyrazol-3-yl)oxyethyl]-4-phenylpiperidine;oxalic acid |
|---|---|
| PubChem CID | 66608253 |
| Molecular Formula | C24H33N3O5 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | 1-[2-(1-cyclohexylpyrazol-3-yl)oxyethyl]-4-phenylpiperidine;oxalic acid |
| SMILES | O=C(O)C(=O)O.c1ccc(C2CCN(CCOc3ccn(C4CCCCC4)n3)CC2)cc1 |
| InChI | InChI=1S/C22H31N3O.C2H2O4/c1-3-7-19(8-4-1)20-11-14-24(15-12-20)17-18-26-22-13-16-25(23-22)21-9-5-2-6-10-21;3-1(4)2(5)6/h1,3-4,7-8,13,16,20-21H,2,5-6,9-12,14-15,17-18H2;(H,3,4)(H,5,6) |
| InChIKey | VJWIVVPZHPXARQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|