C29H40N4O9 — CID 71711950
bis((Z)-but-2-enedioic acid);2-[4-(4-cyclohexylpiperazin-1-yl)butoxy]pyrazolo[1,5-a]pyridine (PubChem CID 71711950) has the molecular formula C29H40N4O9 and a molecular weight of 588.66 g/mol. Its IUPAC name is bis((Z)-but-2-enedioic acid);2-[4-(4-cyclohexylpiperazin-1-yl)butoxy]pyrazolo[1,5-a]pyridine.
| Compound Name | bis((Z)-but-2-enedioic acid);2-[4-(4-cyclohexylpiperazin-1-yl)butoxy]pyrazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 71711950 |
| Molecular Formula | C29H40N4O9 |
| Molecular Weight | 588.66 g/mol |
| Exact Mass | 588.28 |
| IUPAC Name | bis((Z)-but-2-enedioic acid);2-[4-(4-cyclohexylpiperazin-1-yl)butoxy]pyrazolo[1,5-a]pyridine |
| SMILES | O=C(O)/C=C\C(=O)O.O=C(O)/C=C\C(=O)O.c1ccn2nc(OCCCCN3CCN(C4CCCCC4)CC3)cc2c1 |
| InChI | InChI=1S/C21H32N4O.2C4H4O4/c1-2-8-19(9-3-1)24-15-13-23(14-16-24)11-6-7-17-26-21-18-20-10-4-5-12-25(20)22-21;2*5-3(6)1-2-4(7)8/h4-5,10,12,18-19H,1-3,6-9,11,13-17H2;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1- |
| InChIKey | FYFJOPIZOKBXAM-SPIKMXEPSA-N |
| XLogP | 2.87 |
| TPSA | 182.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.66 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|