C27H37N5O9 — CID 71712150
bis((Z)-but-2-enedioic acid);2-[2-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]ethoxy]pyrazolo[1,5-a]pyridine (PubChem CID 71712150) has the molecular formula C27H37N5O9 and a molecular weight of 575.62 g/mol. Its IUPAC name is bis((Z)-but-2-enedioic acid);2-[2-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]ethoxy]pyrazolo[1,5-a]pyridine.
| Compound Name | bis((Z)-but-2-enedioic acid);2-[2-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]ethoxy]pyrazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 71712150 |
| Molecular Formula | C27H37N5O9 |
| Molecular Weight | 575.62 g/mol |
| Exact Mass | 575.26 |
| IUPAC Name | bis((Z)-but-2-enedioic acid);2-[2-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]ethoxy]pyrazolo[1,5-a]pyridine |
| SMILES | CN1CCC(N2CCN(CCOc3cc4ccccn4n3)CC2)CC1.O=C(O)/C=C\C(=O)O.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C19H29N5O.2C4H4O4/c1-21-8-5-17(6-9-21)23-12-10-22(11-13-23)14-15-25-19-16-18-4-2-3-7-24(18)20-19;2*5-3(6)1-2-4(7)8/h2-4,7,16-17H,5-6,8-15H2,1H3;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1- |
| InChIKey | SBIMTELRISYHGN-SPIKMXEPSA-N |
| XLogP | 0.85 |
| TPSA | 185.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.62 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|