C17H27N3O — CID 158648204
methane;2-(4-piperidin-1-ylbutoxy)pyrazolo[1,5-a]pyridine (PubChem CID 158648204) has the molecular formula C17H27N3O and a molecular weight of 289.42 g/mol. Its IUPAC name is methane;2-(4-piperidin-1-ylbutoxy)pyrazolo[1,5-a]pyridine.
| Compound Name | methane;2-(4-piperidin-1-ylbutoxy)pyrazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 158648204 |
| Molecular Formula | C17H27N3O |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | methane;2-(4-piperidin-1-ylbutoxy)pyrazolo[1,5-a]pyridine |
| SMILES | C.c1ccn2nc(OCCCCN3CCCCC3)cc2c1 |
| InChI | InChI=1S/C16H23N3O.CH4/c1-3-9-18(10-4-1)11-6-7-13-20-16-14-15-8-2-5-12-19(15)17-16;/h2,5,8,12,14H,1,3-4,6-7,9-11,13H2;1H4 |
| InChIKey | IBFMKDATYGVOAX-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 29.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|