C17H23N3O5 — CID 71711797
oxalic acid;2-(4-pyrrolidin-1-ylbutoxy)pyrazolo[1,5-a]pyridine (PubChem CID 71711797) has the molecular formula C17H23N3O5 and a molecular weight of 349.39 g/mol. Its IUPAC name is oxalic acid;2-(4-pyrrolidin-1-ylbutoxy)pyrazolo[1,5-a]pyridine.
| Compound Name | oxalic acid;2-(4-pyrrolidin-1-ylbutoxy)pyrazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 71711797 |
| Molecular Formula | C17H23N3O5 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | oxalic acid;2-(4-pyrrolidin-1-ylbutoxy)pyrazolo[1,5-a]pyridine |
| SMILES | O=C(O)C(=O)O.c1ccn2nc(OCCCCN3CCCC3)cc2c1 |
| InChI | InChI=1S/C15H21N3O.C2H2O4/c1-2-11-18-14(7-1)13-15(16-18)19-12-6-5-10-17-8-3-4-9-17;3-1(4)2(5)6/h1-2,7,11,13H,3-6,8-10,12H2;(H,3,4)(H,5,6) |
| InChIKey | ANVGKVNQZPCKBA-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|