C21H34N4O6 — CID 66608731
1-[4-[4-(1-cyclohexylpyrazol-3-yl)oxybutyl]piperazin-1-yl]ethanone;oxalic acid (PubChem CID 66608731) has the molecular formula C21H34N4O6 and a molecular weight of 438.53 g/mol. Its IUPAC name is 1-[4-[4-(1-cyclohexylpyrazol-3-yl)oxybutyl]piperazin-1-yl]ethanone;oxalic acid.
| Compound Name | 1-[4-[4-(1-cyclohexylpyrazol-3-yl)oxybutyl]piperazin-1-yl]ethanone;oxalic acid |
|---|---|
| PubChem CID | 66608731 |
| Molecular Formula | C21H34N4O6 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | 1-[4-[4-(1-cyclohexylpyrazol-3-yl)oxybutyl]piperazin-1-yl]ethanone;oxalic acid |
| SMILES | CC(=O)N1CCN(CCCCOc2ccn(C3CCCCC3)n2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H32N4O2.C2H2O4/c1-17(24)22-14-12-21(13-15-22)10-5-6-16-25-19-9-11-23(20-19)18-7-3-2-4-8-18;3-1(4)2(5)6/h9,11,18H,2-8,10,12-16H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | AOZZVQCAKBTSLH-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 125.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|