C7H10N4O4S — CID 70625699
6-(dimethylamino)-5-nitropyridine-3-sulfonamide (PubChem CID 70625699) has the molecular formula C7H10N4O4S and a molecular weight of 246.25 g/mol. Its IUPAC name is 6-(dimethylamino)-5-nitropyridine-3-sulfonamide.
| Compound Name | 6-(dimethylamino)-5-nitropyridine-3-sulfonamide |
|---|---|
| PubChem CID | 70625699 |
| Molecular Formula | C7H10N4O4S |
| Molecular Weight | 246.25 g/mol |
| Exact Mass | 246.04 |
| IUPAC Name | 6-(dimethylamino)-5-nitropyridine-3-sulfonamide |
| SMILES | CN(C)c1ncc(S(N)(=O)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H10N4O4S/c1-10(2)7-6(11(12)13)3-5(4-9-7)16(8,14)15/h3-4H,1-2H3,(H2,8,14,15) |
| InChIKey | JIJUZGUTDSIXOW-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 119.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.25 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|