C18H19ClO4S — CID 70626143
[2-(2-chloro-4-phenylphenoxy)cyclohexyl] hydrogen sulfite (PubChem CID 70626143) has the molecular formula C18H19ClO4S and a molecular weight of 366.87 g/mol. Its IUPAC name is [2-(2-chloro-4-phenylphenoxy)cyclohexyl] hydrogen sulfite.
| Compound Name | [2-(2-chloro-4-phenylphenoxy)cyclohexyl] hydrogen sulfite |
|---|---|
| PubChem CID | 70626143 |
| Molecular Formula | C18H19ClO4S |
| Molecular Weight | 366.87 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | [2-(2-chloro-4-phenylphenoxy)cyclohexyl] hydrogen sulfite |
| SMILES | O=S(O)OC1CCCCC1Oc1ccc(-c2ccccc2)cc1Cl |
| InChI | InChI=1S/C18H19ClO4S/c19-15-12-14(13-6-2-1-3-7-13)10-11-16(15)22-17-8-4-5-9-18(17)23-24(20)21/h1-3,6-7,10-12,17-18H,4-5,8-9H2,(H,20,21) |
| InChIKey | HUQNFTCRQSHNDP-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.87 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|