About bis(3-amino-N-(aminomethylidene)pyrazine-2-carboxamide);hydrate
bis(3-amino-N-(aminomethylidene)pyrazine-2-carboxamide);hydrate (PubChem CID 70628736) has the molecular formula C12H16N10O3
and a molecular weight of 348.33 g/mol. Its IUPAC name is bis(3-amino-N-(aminomethylidene)pyrazine-2-carboxamide);hydrate.
Molecular Properties
| Compound Name | bis(3-amino-N-(aminomethylidene)pyrazine-2-carboxamide);hydrate |
| PubChem CID | 70628736 |
| Molecular Formula | C12H16N10O3 |
| Molecular Weight | 348.33 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | bis(3-amino-N-(aminomethylidene)pyrazine-2-carboxamide);hydrate |
| SMILES | N/C=N/C(=O)c1nccnc1N.N/C=N/C(=O)c1nccnc1N.O |
| InChI | InChI=1S/2C6H7N5O.H2O/c2*7-3-11-6(12)4-5(8)10-2-1-9-4;/h2*1-3H,(H2,8,10)(H2,7,11,12);1H2 |
| InChIKey | BLTZKUBLPZXBJX-UHFFFAOYSA-N |
| XLogP | -2.45 |
| TPSA | 246.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.33 |
| LogP ≤ 5 | -2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze bis(3-amino-N-(aminomethylidene)pyrazine-2-carboxamide);hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3-amino-N-(aminomethylidene)pyrazine-2-carboxamide);hydrate?
The IUPAC name of bis(3-amino-N-(aminomethylidene)pyrazine-2-carboxamide);hydrate (CID 70628736) is bis(3-amino-N-(aminomethylidene)pyrazine-2-carboxamide);hydrate.
What is the SMILES notation for bis(3-amino-N-(aminomethylidene)pyrazine-2-carboxamide);hydrate?
The canonical SMILES for bis(3-amino-N-(aminomethylidene)pyrazine-2-carboxamide);hydrate is N/C=N/C(=O)c1nccnc1N.N/C=N/C(=O)c1nccnc1N.O.
What is the InChIKey of bis(3-amino-N-(aminomethylidene)pyrazine-2-carboxamide);hydrate?
The InChIKey is BLTZKUBLPZXBJX-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H7N5O.H2O/c2*7-3-11-6(12)4-5(8)10-2-1-9-4;/h2*1-3H,(H2,8,10)(H2,7,11,12);1H2.
What are the key properties of bis(3-amino-N-(aminomethylidene)pyrazine-2-carboxamide);hydrate?
bis(3-amino-N-(aminomethylidene)pyrazine-2-carboxamide);hydrate has a molecular weight of 348.33 g/mol, XLogP of -2.45, 2 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3-amino-N-(aminomethylidene)pyrazine-2-carboxamide);hydrate is sourced from PubChem (CID 70628736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).