C9H14O5 — CID 70630202
[2-(1,2-dihydroxyethyl)oxetan-2-yl] but-3-enoate (PubChem CID 70630202) has the molecular formula C9H14O5 and a molecular weight of 202.21 g/mol. Its IUPAC name is [2-(1,2-dihydroxyethyl)oxetan-2-yl] but-3-enoate.
| Compound Name | [2-(1,2-dihydroxyethyl)oxetan-2-yl] but-3-enoate |
|---|---|
| PubChem CID | 70630202 |
| Molecular Formula | C9H14O5 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | [2-(1,2-dihydroxyethyl)oxetan-2-yl] but-3-enoate |
| SMILES | C=CCC(=O)OC1(C(O)CO)CCO1 |
| InChI | InChI=1S/C9H14O5/c1-2-3-8(12)14-9(4-5-13-9)7(11)6-10/h2,7,10-11H,1,3-6H2 |
| InChIKey | DFXLLZHOHHGHKM-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|