C20H30N2O2 — CID 70631711
(E)-1-[(2R,6S)-2,6-dimethyl-4-(3-phenylpropyl)piperazin-1-yl]-3-ethoxyprop-2-en-1-one (PubChem CID 70631711) has the molecular formula C20H30N2O2 and a molecular weight of 330.47 g/mol. Its IUPAC name is (E)-1-[(2R,6S)-2,6-dimethyl-4-(3-phenylpropyl)piperazin-1-yl]-3-ethoxyprop-2-en-1-one.
| Compound Name | (E)-1-[(2R,6S)-2,6-dimethyl-4-(3-phenylpropyl)piperazin-1-yl]-3-ethoxyprop-2-en-1-one |
|---|---|
| PubChem CID | 70631711 |
| Molecular Formula | C20H30N2O2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | (E)-1-[(2R,6S)-2,6-dimethyl-4-(3-phenylpropyl)piperazin-1-yl]-3-ethoxyprop-2-en-1-one |
| SMILES | CCO/C=C/C(=O)N1[C@H](C)CN(CCCc2ccccc2)C[C@@H]1C |
| InChI | InChI=1S/C20H30N2O2/c1-4-24-14-12-20(23)22-17(2)15-21(16-18(22)3)13-8-11-19-9-6-5-7-10-19/h5-7,9-10,12,14,17-18H,4,8,11,13,15-16H2,1-3H3/b14-12+/t17-,18+ |
| InChIKey | FPGDORLXNHSOOF-WFYJGQQCSA-N |
| XLogP | 3.09 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|