About [ethoxy-(2-methylsulfanylethylimino)-propylsulfanyl-λ5-phosphanyl] N-phenylcarbamate
[ethoxy-(2-methylsulfanylethylimino)-propylsulfanyl-λ5-phosphanyl] N-phenylcarbamate (PubChem CID 70634547) has the molecular formula C15H25N2O3PS2
and a molecular weight of 376.48 g/mol. Its IUPAC name is [ethoxy-(2-methylsulfanylethylimino)-propylsulfanyl-λ5-phosphanyl] N-phenylcarbamate.
Molecular Properties
| Compound Name | [ethoxy-(2-methylsulfanylethylimino)-propylsulfanyl-λ5-phosphanyl] N-phenylcarbamate |
| PubChem CID | 70634547 |
| Molecular Formula | C15H25N2O3PS2 |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | [ethoxy-(2-methylsulfanylethylimino)-propylsulfanyl-λ5-phosphanyl] N-phenylcarbamate |
| SMILES | CCCSP(=NCCSC)(OCC)OC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C15H25N2O3PS2/c1-4-12-23-21(19-5-2,16-11-13-22-3)20-15(18)17-14-9-7-6-8-10-14/h6-10H,4-5,11-13H2,1-3H3,(H,17,18) |
| InChIKey | SLSBAORXNRXNMW-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [ethoxy-(2-methylsulfanylethylimino)-propylsulfanyl-λ5-phosphanyl] N-phenylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [ethoxy-(2-methylsulfanylethylimino)-propylsulfanyl-λ5-phosphanyl] N-phenylcarbamate?
The IUPAC name of [ethoxy-(2-methylsulfanylethylimino)-propylsulfanyl-λ5-phosphanyl] N-phenylcarbamate (CID 70634547) is [ethoxy-(2-methylsulfanylethylimino)-propylsulfanyl-λ5-phosphanyl] N-phenylcarbamate.
What is the SMILES notation for [ethoxy-(2-methylsulfanylethylimino)-propylsulfanyl-λ5-phosphanyl] N-phenylcarbamate?
The canonical SMILES for [ethoxy-(2-methylsulfanylethylimino)-propylsulfanyl-λ5-phosphanyl] N-phenylcarbamate is CCCSP(=NCCSC)(OCC)OC(=O)Nc1ccccc1.
What is the InChIKey of [ethoxy-(2-methylsulfanylethylimino)-propylsulfanyl-λ5-phosphanyl] N-phenylcarbamate?
The InChIKey is SLSBAORXNRXNMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N2O3PS2/c1-4-12-23-21(19-5-2,16-11-13-22-3)20-15(18)17-14-9-7-6-8-10-14/h6-10H,4-5,11-13H2,1-3H3,(H,17,18).
What are the key properties of [ethoxy-(2-methylsulfanylethylimino)-propylsulfanyl-λ5-phosphanyl] N-phenylcarbamate?
[ethoxy-(2-methylsulfanylethylimino)-propylsulfanyl-λ5-phosphanyl] N-phenylcarbamate has a molecular weight of 376.48 g/mol, XLogP of 5.72, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [ethoxy-(2-methylsulfanylethylimino)-propylsulfanyl-λ5-phosphanyl] N-phenylcarbamate is sourced from PubChem (CID 70634547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).