C14H21NO4 — CID 70635188
methyl 3-[2-(tert-butylamino)-2-hydroxyethyl]-5-hydroxybenzoate (PubChem CID 70635188) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is methyl 3-[2-(tert-butylamino)-2-hydroxyethyl]-5-hydroxybenzoate.
| Compound Name | methyl 3-[2-(tert-butylamino)-2-hydroxyethyl]-5-hydroxybenzoate |
|---|---|
| PubChem CID | 70635188 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | methyl 3-[2-(tert-butylamino)-2-hydroxyethyl]-5-hydroxybenzoate |
| SMILES | COC(=O)c1cc(O)cc(CC(O)NC(C)(C)C)c1 |
| InChI | InChI=1S/C14H21NO4/c1-14(2,3)15-12(17)7-9-5-10(13(18)19-4)8-11(16)6-9/h5-6,8,12,15-17H,7H2,1-4H3 |
| InChIKey | UNSGZNIMSXYMKQ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|