C18H24F2NO+ — CID 7063679
1-adamantyl-[[4-(difluoromethoxy)phenyl]methyl]azanium (PubChem CID 7063679) has the molecular formula C18H24F2NO+ and a molecular weight of 308.39 g/mol. Its IUPAC name is 1-adamantyl-[[4-(difluoromethoxy)phenyl]methyl]azanium.
| Compound Name | 1-adamantyl-[[4-(difluoromethoxy)phenyl]methyl]azanium |
|---|---|
| PubChem CID | 7063679 |
| Molecular Formula | C18H24F2NO+ |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 1-adamantyl-[[4-(difluoromethoxy)phenyl]methyl]azanium |
| SMILES | FC(F)Oc1ccc(C[NH2+]C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C18H23F2NO/c19-17(20)22-16-3-1-12(2-4-16)11-21-18-8-13-5-14(9-18)7-15(6-13)10-18/h1-4,13-15,17,21H,5-11H2/p+1 |
| InChIKey | VIWLPYISTUWEGD-UHFFFAOYSA-O |
| XLogP | 3.32 |
| TPSA | 25.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |