C7H8N2O3S — CID 7063826
methyl 2-(4-oxo-2-sulfanylidene-1H-pyrimidin-6-yl)acetate (PubChem CID 7063826) has the molecular formula C7H8N2O3S and a molecular weight of 200.22 g/mol. Its IUPAC name is methyl 2-(4-oxo-2-sulfanylidene-1H-pyrimidin-6-yl)acetate.
| Compound Name | methyl 2-(4-oxo-2-sulfanylidene-1H-pyrimidin-6-yl)acetate |
|---|---|
| PubChem CID | 7063826 |
| Molecular Formula | C7H8N2O3S |
| Molecular Weight | 200.22 g/mol |
| Exact Mass | 200.03 |
| IUPAC Name | methyl 2-(4-oxo-2-sulfanylidene-1H-pyrimidin-6-yl)acetate |
| SMILES | COC(=O)Cc1cc(=O)[nH]c(=S)[nH]1 |
| InChI | InChI=1S/C7H8N2O3S/c1-12-6(11)3-4-2-5(10)9-7(13)8-4/h2H,3H2,1H3,(H2,8,9,10,13) |
| InChIKey | OPVUEYDEWBEOLI-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 74.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.22 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|